C9H13IN2O2S — CID 97161027
(3S)-3-(4-iodo-3,5-dimethylpyrazol-1-yl)thiolane 1,1-dioxide (PubChem CID 97161027) has the molecular formula C9H13IN2O2S and a molecular weight of 340.19 g/mol. Its IUPAC name is (3S)-3-(4-iodo-3,5-dimethylpyrazol-1-yl)thiolane 1,1-dioxide.
| Compound Name | (3S)-3-(4-iodo-3,5-dimethylpyrazol-1-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 97161027 |
| Molecular Formula | C9H13IN2O2S |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | (3S)-3-(4-iodo-3,5-dimethylpyrazol-1-yl)thiolane 1,1-dioxide |
| SMILES | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1I |
| InChI | InChI=1S/C9H13IN2O2S/c1-6-9(10)7(2)12(11-6)8-3-4-15(13,14)5-8/h8H,3-5H2,1-2H3/t8-/m0/s1 |
| InChIKey | HOMAQDWMORHNOB-QMMMGPOBSA-N |
| XLogP | 1.46 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|