C10H15N3O3S — CID 99977007
N-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]formamide (PubChem CID 99977007) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is N-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]formamide.
| Compound Name | N-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]formamide |
|---|---|
| PubChem CID | 99977007 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]formamide |
| SMILES | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1NC=O |
| InChI | InChI=1S/C10H15N3O3S/c1-7-10(11-6-14)8(2)13(12-7)9-3-4-17(15,16)5-9/h6,9H,3-5H2,1-2H3,(H,11,14)/t9-/m0/s1 |
| InChIKey | ZGOBEBJMPZUAIB-VIFPVBQESA-N |
| XLogP | 0.43 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|