C8H13N3O2S — CID 129382111
1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-amine (PubChem CID 129382111) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-amine.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-amine |
|---|---|
| PubChem CID | 129382111 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-amine |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)cc1N |
| InChI | InChI=1S/C8H13N3O2S/c1-6-8(9)4-11(10-6)7-2-3-14(12,13)5-7/h4,7H,2-3,5,9H2,1H3/t7-/m1/s1 |
| InChIKey | FASQCSVRSZQIPL-SSDOTTSWSA-N |
| XLogP | 0.13 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |