About 3-(2,5-dimethylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine
3-(2,5-dimethylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine (PubChem CID 83204152) has the molecular formula C15H19N3O2S
and a molecular weight of 305.40 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine.
Molecular Properties
| Compound Name | 3-(2,5-dimethylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine |
| PubChem CID | 83204152 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine |
| SMILES | Cc1ccc(C)c(-c2nn(C3CCS(=O)(=O)C3)cc2N)c1 |
| InChI | InChI=1S/C15H19N3O2S/c1-10-3-4-11(2)13(7-10)15-14(16)8-18(17-15)12-5-6-21(19,20)9-12/h3-4,7-8,12H,5-6,9,16H2,1-2H3 |
| InChIKey | NSEMYUOXUCRLBL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,5-dimethylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine?
The IUPAC name of 3-(2,5-dimethylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine (CID 83204152) is 3-(2,5-dimethylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine.
What is the SMILES notation for 3-(2,5-dimethylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine?
The canonical SMILES for 3-(2,5-dimethylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine is Cc1ccc(C)c(-c2nn(C3CCS(=O)(=O)C3)cc2N)c1.
What is the InChIKey of 3-(2,5-dimethylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine?
The InChIKey is NSEMYUOXUCRLBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2S/c1-10-3-4-11(2)13(7-10)15-14(16)8-18(17-15)12-5-6-21(19,20)9-12/h3-4,7-8,12H,5-6,9,16H2,1-2H3.
What are the key properties of 3-(2,5-dimethylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine?
3-(2,5-dimethylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine has a molecular weight of 305.40 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine is sourced from PubChem (CID 83204152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).