C14H16ClN3O2S — CID 106861410
3-(2-chloro-4-methylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine (PubChem CID 106861410) has the molecular formula C14H16ClN3O2S and a molecular weight of 325.82 g/mol. Its IUPAC name is 3-(2-chloro-4-methylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine.
| Compound Name | 3-(2-chloro-4-methylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine |
|---|---|
| PubChem CID | 106861410 |
| Molecular Formula | C14H16ClN3O2S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 3-(2-chloro-4-methylphenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine |
| SMILES | Cc1ccc(-c2cc(N)n(C3CCS(=O)(=O)C3)n2)c(Cl)c1 |
| InChI | InChI=1S/C14H16ClN3O2S/c1-9-2-3-11(12(15)6-9)13-7-14(16)18(17-13)10-4-5-21(19,20)8-10/h2-3,6-7,10H,4-5,8,16H2,1H3 |
| InChIKey | YLVRMNPZMKEXOZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |