C10H17N3O3S — CID 43159044
1-(1,1-dioxothiolan-3-yl)-3-(2-methoxyethyl)pyrazol-5-amine (PubChem CID 43159044) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(2-methoxyethyl)pyrazol-5-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(2-methoxyethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 43159044 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(2-methoxyethyl)pyrazol-5-amine |
| SMILES | COCCc1cc(N)n(C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C10H17N3O3S/c1-16-4-2-8-6-10(11)13(12-8)9-3-5-17(14,15)7-9/h6,9H,2-5,7,11H2,1H3 |
| InChIKey | XNFDEJOMAVFYPY-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |