C14H23N3O2S — CID 43336856
3-(2-cyclopentylethyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine (PubChem CID 43336856) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 3-(2-cyclopentylethyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine.
| Compound Name | 3-(2-cyclopentylethyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine |
|---|---|
| PubChem CID | 43336856 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-(2-cyclopentylethyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine |
| SMILES | Nc1cc(CCC2CCCC2)nn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H23N3O2S/c15-14-9-12(6-5-11-3-1-2-4-11)16-17(14)13-7-8-20(18,19)10-13/h9,11,13H,1-8,10,15H2 |
| InChIKey | ZSMAMGNBSRAIDY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |