C13H17N3O3S — CID 43159059
1-(1,1-dioxothiolan-3-yl)-3-[2-(furan-2-yl)ethyl]pyrazol-5-amine (PubChem CID 43159059) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[2-(furan-2-yl)ethyl]pyrazol-5-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[2-(furan-2-yl)ethyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 43159059 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[2-(furan-2-yl)ethyl]pyrazol-5-amine |
| SMILES | Nc1cc(CCc2ccco2)nn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17N3O3S/c14-13-8-10(3-4-12-2-1-6-19-12)15-16(13)11-5-7-20(17,18)9-11/h1-2,6,8,11H,3-5,7,9,14H2 |
| InChIKey | ACMUOVZLPHEQRI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |