C12H19N3O3S — CID 62906041
1-(1,1-dioxothiolan-3-yl)-3-(oxan-4-yl)pyrazol-5-amine (PubChem CID 62906041) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(oxan-4-yl)pyrazol-5-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(oxan-4-yl)pyrazol-5-amine |
|---|---|
| PubChem CID | 62906041 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(oxan-4-yl)pyrazol-5-amine |
| SMILES | Nc1cc(C2CCOCC2)nn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H19N3O3S/c13-12-7-11(9-1-4-18-5-2-9)14-15(12)10-3-6-19(16,17)8-10/h7,9-10H,1-6,8,13H2 |
| InChIKey | UCYPVKOLLDPUAA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |