C12H14N4O3S — CID 136710584
5-[5-amino-1-(1,1-dioxothiolan-3-yl)pyrazol-3-yl]-1H-pyridin-2-one (PubChem CID 136710584) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is 5-[5-amino-1-(1,1-dioxothiolan-3-yl)pyrazol-3-yl]-1H-pyridin-2-one.
| Compound Name | 5-[5-amino-1-(1,1-dioxothiolan-3-yl)pyrazol-3-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 136710584 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 5-[5-amino-1-(1,1-dioxothiolan-3-yl)pyrazol-3-yl]-1H-pyridin-2-one |
| SMILES | Nc1cc(-c2ccc(=O)[nH]c2)nn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14N4O3S/c13-11-5-10(8-1-2-12(17)14-6-8)15-16(11)9-3-4-20(18,19)7-9/h1-2,5-6,9H,3-4,7,13H2,(H,14,17) |
| InChIKey | CCEZYWSUKRVETR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |