C15H19N3O2S — CID 93296243
3-(2,4-dimethylphenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]pyrazol-5-amine (PubChem CID 93296243) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]pyrazol-5-amine.
| Compound Name | 3-(2,4-dimethylphenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]pyrazol-5-amine |
|---|---|
| PubChem CID | 93296243 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]pyrazol-5-amine |
| SMILES | Cc1ccc(-c2cc(N)n([C@@H]3CCS(=O)(=O)C3)n2)c(C)c1 |
| InChI | InChI=1S/C15H19N3O2S/c1-10-3-4-13(11(2)7-10)14-8-15(16)18(17-14)12-5-6-21(19,20)9-12/h3-4,7-8,12H,5-6,9,16H2,1-2H3/t12-/m1/s1 |
| InChIKey | IJTUJCGDYHGWBR-GFCCVEGCSA-N |
| XLogP | 2.11 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |