C11H12BrN3O3S — CID 104653695
3-(5-bromofuran-2-yl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine (PubChem CID 104653695) has the molecular formula C11H12BrN3O3S and a molecular weight of 346.21 g/mol. Its IUPAC name is 3-(5-bromofuran-2-yl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine.
| Compound Name | 3-(5-bromofuran-2-yl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine |
|---|---|
| PubChem CID | 104653695 |
| Molecular Formula | C11H12BrN3O3S |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 3-(5-bromofuran-2-yl)-1-(1,1-dioxothiolan-3-yl)pyrazol-4-amine |
| SMILES | Nc1cn(C2CCS(=O)(=O)C2)nc1-c1ccc(Br)o1 |
| InChI | InChI=1S/C11H12BrN3O3S/c12-10-2-1-9(18-10)11-8(13)5-15(14-11)7-3-4-19(16,17)6-7/h1-2,5,7H,3-4,6,13H2 |
| InChIKey | LOIVHSOOTOQQEQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |