C15H22N2O3S — CID 104508628
3-cycloheptyl-1-(1,1-dioxothiolan-3-yl)pyrazole-4-carbaldehyde (PubChem CID 104508628) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-cycloheptyl-1-(1,1-dioxothiolan-3-yl)pyrazole-4-carbaldehyde.
| Compound Name | 3-cycloheptyl-1-(1,1-dioxothiolan-3-yl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 104508628 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-cycloheptyl-1-(1,1-dioxothiolan-3-yl)pyrazole-4-carbaldehyde |
| SMILES | O=Cc1cn(C2CCS(=O)(=O)C2)nc1C1CCCCCC1 |
| InChI | InChI=1S/C15H22N2O3S/c18-10-13-9-17(14-7-8-21(19,20)11-14)16-15(13)12-5-3-1-2-4-6-12/h9-10,12,14H,1-8,11H2 |
| InChIKey | JKCGCKLCFLFAPM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|