C7H10N2O2S — CID 43531677
3-pyrazol-1-ylthiolane 1,1-dioxide (PubChem CID 43531677) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 3-pyrazol-1-ylthiolane 1,1-dioxide.
| Compound Name | 3-pyrazol-1-ylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 43531677 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 3-pyrazol-1-ylthiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(n2cccn2)C1 |
| InChI | InChI=1S/C7H10N2O2S/c10-12(11)5-2-7(6-12)9-4-1-3-8-9/h1,3-4,7H,2,5-6H2 |
| InChIKey | PFIFVPYNENWRNN-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |