C12H19N3O2S — CID 126900371
4-[(3-pyrazol-1-ylazetidin-1-yl)methyl]thiane 1,1-dioxide (PubChem CID 126900371) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-[(3-pyrazol-1-ylazetidin-1-yl)methyl]thiane 1,1-dioxide.
| Compound Name | 4-[(3-pyrazol-1-ylazetidin-1-yl)methyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 126900371 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-[(3-pyrazol-1-ylazetidin-1-yl)methyl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(CN2CC(n3cccn3)C2)CC1 |
| InChI | InChI=1S/C12H19N3O2S/c16-18(17)6-2-11(3-7-18)8-14-9-12(10-14)15-5-1-4-13-15/h1,4-5,11-12H,2-3,6-10H2 |
| InChIKey | FKOQRPRSGXVKLU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |