C10H15N3 — CID 130778362
1-(1-prop-2-enylpyrrolidin-3-yl)pyrazole (PubChem CID 130778362) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-(1-prop-2-enylpyrrolidin-3-yl)pyrazole.
| Compound Name | 1-(1-prop-2-enylpyrrolidin-3-yl)pyrazole |
|---|---|
| PubChem CID | 130778362 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1-(1-prop-2-enylpyrrolidin-3-yl)pyrazole |
| SMILES | C=CCN1CCC(n2cccn2)C1 |
| InChI | InChI=1S/C10H15N3/c1-2-6-12-8-4-10(9-12)13-7-3-5-11-13/h2-3,5,7,10H,1,4,6,8-9H2 |
| InChIKey | GVADASMSKUYLQL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|