C13H17N5O — CID 126946527
1-methyl-6-[(3-pyrazol-1-ylpyrrolidin-1-yl)methyl]pyrazin-2-one (PubChem CID 126946527) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-methyl-6-[(3-pyrazol-1-ylpyrrolidin-1-yl)methyl]pyrazin-2-one.
| Compound Name | 1-methyl-6-[(3-pyrazol-1-ylpyrrolidin-1-yl)methyl]pyrazin-2-one |
|---|---|
| PubChem CID | 126946527 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-methyl-6-[(3-pyrazol-1-ylpyrrolidin-1-yl)methyl]pyrazin-2-one |
| SMILES | Cn1c(CN2CCC(n3cccn3)C2)cncc1=O |
| InChI | InChI=1S/C13H17N5O/c1-16-12(7-14-8-13(16)19)10-17-6-3-11(9-17)18-5-2-4-15-18/h2,4-5,7-8,11H,3,6,9-10H2,1H3 |
| InChIKey | FGCOONHDJIUCDJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |