C10H14N6 — CID 126900246
2-methyl-4-[(3-pyrazol-1-ylazetidin-1-yl)methyl]triazole (PubChem CID 126900246) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-methyl-4-[(3-pyrazol-1-ylazetidin-1-yl)methyl]triazole.
| Compound Name | 2-methyl-4-[(3-pyrazol-1-ylazetidin-1-yl)methyl]triazole |
|---|---|
| PubChem CID | 126900246 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-methyl-4-[(3-pyrazol-1-ylazetidin-1-yl)methyl]triazole |
| SMILES | Cn1ncc(CN2CC(n3cccn3)C2)n1 |
| InChI | InChI=1S/C10H14N6/c1-14-12-5-9(13-14)6-15-7-10(8-15)16-4-2-3-11-16/h2-5,10H,6-8H2,1H3 |
| InChIKey | BPIZFWOIPFFIIF-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |