C16H23N7 — CID 126893462
1-[1-[(2-methyltriazol-4-yl)methyl]azetidin-3-yl]-4-pyridin-2-ylpiperazine (PubChem CID 126893462) has the molecular formula C16H23N7 and a molecular weight of 313.41 g/mol. Its IUPAC name is 1-[1-[(2-methyltriazol-4-yl)methyl]azetidin-3-yl]-4-pyridin-2-ylpiperazine.
| Compound Name | 1-[1-[(2-methyltriazol-4-yl)methyl]azetidin-3-yl]-4-pyridin-2-ylpiperazine |
|---|---|
| PubChem CID | 126893462 |
| Molecular Formula | C16H23N7 |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-[1-[(2-methyltriazol-4-yl)methyl]azetidin-3-yl]-4-pyridin-2-ylpiperazine |
| SMILES | Cn1ncc(CN2CC(N3CCN(c4ccccn4)CC3)C2)n1 |
| InChI | InChI=1S/C16H23N7/c1-20-18-10-14(19-20)11-21-12-15(13-21)22-6-8-23(9-7-22)16-4-2-3-5-17-16/h2-5,10,15H,6-9,11-13H2,1H3 |
| InChIKey | LNCRSHUXCKGBIN-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 53.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |