C8H10N2O3S — CID 84734827
2-(1,1-dioxothiolan-3-yl)pyrazole-3-carbaldehyde (PubChem CID 84734827) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)pyrazole-3-carbaldehyde.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)pyrazole-3-carbaldehyde |
|---|---|
| PubChem CID | 84734827 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)pyrazole-3-carbaldehyde |
| SMILES | O=Cc1ccnn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H10N2O3S/c11-5-7-1-3-9-10(7)8-2-4-14(12,13)6-8/h1,3,5,8H,2,4,6H2 |
| InChIKey | OGGSHLIZJBVWEU-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|