C14H17N3O3S2 — CID 71993648
N-[2-(1,1-dioxothiolan-3-yl)pyrazol-3-yl]-3-thiophen-3-ylpropanamide (PubChem CID 71993648) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[2-(1,1-dioxothiolan-3-yl)pyrazol-3-yl]-3-thiophen-3-ylpropanamide.
| Compound Name | N-[2-(1,1-dioxothiolan-3-yl)pyrazol-3-yl]-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 71993648 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-[2-(1,1-dioxothiolan-3-yl)pyrazol-3-yl]-3-thiophen-3-ylpropanamide |
| SMILES | O=C(CCc1ccsc1)Nc1ccnn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H17N3O3S2/c18-14(2-1-11-4-7-21-9-11)16-13-3-6-15-17(13)12-5-8-22(19,20)10-12/h3-4,6-7,9,12H,1-2,5,8,10H2,(H,16,18) |
| InChIKey | KBVYDCAVEHTQHT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |