C16H22N4OS — CID 9437889
N-(2-cyclopentylpyrazol-3-yl)-2-[methyl(thiophen-3-ylmethyl)amino]acetamide (PubChem CID 9437889) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is N-(2-cyclopentylpyrazol-3-yl)-2-[methyl(thiophen-3-ylmethyl)amino]acetamide.
| Compound Name | N-(2-cyclopentylpyrazol-3-yl)-2-[methyl(thiophen-3-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 9437889 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-(2-cyclopentylpyrazol-3-yl)-2-[methyl(thiophen-3-ylmethyl)amino]acetamide |
| SMILES | CN(CC(=O)Nc1ccnn1C1CCCC1)Cc1ccsc1 |
| InChI | InChI=1S/C16H22N4OS/c1-19(10-13-7-9-22-12-13)11-16(21)18-15-6-8-17-20(15)14-4-2-3-5-14/h6-9,12,14H,2-5,10-11H2,1H3,(H,18,21) |
| InChIKey | GAGKXBLHGCENQK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |