C13H13IN2O2S — CID 79787504
3-[4-(2-iodophenyl)pyrazol-1-yl]thiolane 1,1-dioxide (PubChem CID 79787504) has the molecular formula C13H13IN2O2S and a molecular weight of 388.23 g/mol. Its IUPAC name is 3-[4-(2-iodophenyl)pyrazol-1-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[4-(2-iodophenyl)pyrazol-1-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 79787504 |
| Molecular Formula | C13H13IN2O2S |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | 3-[4-(2-iodophenyl)pyrazol-1-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(n2cc(-c3ccccc3I)cn2)C1 |
| InChI | InChI=1S/C13H13IN2O2S/c14-13-4-2-1-3-12(13)10-7-15-16(8-10)11-5-6-19(17,18)9-11/h1-4,7-8,11H,5-6,9H2 |
| InChIKey | AKLYLEVVZPWTFX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|