C15H16N4O4S — CID 2765020
1-(1,1-dioxothiolan-3-yl)-N-(phenylcarbamoyl)pyrazole-4-carboxamide (PubChem CID 2765020) has the molecular formula C15H16N4O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-N-(phenylcarbamoyl)pyrazole-4-carboxamide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-N-(phenylcarbamoyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 2765020 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-N-(phenylcarbamoyl)pyrazole-4-carboxamide |
| SMILES | O=C(NC(=O)c1cnn(C2CCS(=O)(=O)C2)c1)Nc1ccccc1 |
| InChI | InChI=1S/C15H16N4O4S/c20-14(18-15(21)17-12-4-2-1-3-5-12)11-8-16-19(9-11)13-6-7-24(22,23)10-13/h1-5,8-9,13H,6-7,10H2,(H2,17,18,20,21) |
| InChIKey | NLQRSTGECHGKOE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |