C8H8ClIN2O3S — CID 114583749
6-chloro-3-(1,1-dioxothiolan-3-yl)-5-iodopyrimidin-4-one (PubChem CID 114583749) has the molecular formula C8H8ClIN2O3S and a molecular weight of 374.59 g/mol. Its IUPAC name is 6-chloro-3-(1,1-dioxothiolan-3-yl)-5-iodopyrimidin-4-one.
| Compound Name | 6-chloro-3-(1,1-dioxothiolan-3-yl)-5-iodopyrimidin-4-one |
|---|---|
| PubChem CID | 114583749 |
| Molecular Formula | C8H8ClIN2O3S |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 373.90 |
| IUPAC Name | 6-chloro-3-(1,1-dioxothiolan-3-yl)-5-iodopyrimidin-4-one |
| SMILES | O=c1c(I)c(Cl)ncn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H8ClIN2O3S/c9-7-6(10)8(13)12(4-11-7)5-1-2-16(14,15)3-5/h4-5H,1-3H2 |
| InChIKey | RZCRBTMIRQHOQI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|