C12H11ClN2O3S — CID 45232029
5-chloro-3-(1,1-dioxothiolan-3-yl)quinazolin-4-one (PubChem CID 45232029) has the molecular formula C12H11ClN2O3S and a molecular weight of 298.75 g/mol. Its IUPAC name is 5-chloro-3-(1,1-dioxothiolan-3-yl)quinazolin-4-one.
| Compound Name | 5-chloro-3-(1,1-dioxothiolan-3-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 45232029 |
| Molecular Formula | C12H11ClN2O3S |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 5-chloro-3-(1,1-dioxothiolan-3-yl)quinazolin-4-one |
| SMILES | O=c1c2c(Cl)cccc2ncn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H11ClN2O3S/c13-9-2-1-3-10-11(9)12(16)15(7-14-10)8-4-5-19(17,18)6-8/h1-3,7-8H,4-6H2 |
| InChIKey | UFFNSJQEIYLVKI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |