C12H11ClN2O4S — CID 117260913
5-chloro-3-(1,1-dioxothiolan-3-yl)-1H-quinazoline-2,4-dione (PubChem CID 117260913) has the molecular formula C12H11ClN2O4S and a molecular weight of 314.75 g/mol. Its IUPAC name is 5-chloro-3-(1,1-dioxothiolan-3-yl)-1H-quinazoline-2,4-dione.
| Compound Name | 5-chloro-3-(1,1-dioxothiolan-3-yl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117260913 |
| Molecular Formula | C12H11ClN2O4S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 5-chloro-3-(1,1-dioxothiolan-3-yl)-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2cccc(Cl)c2c(=O)n1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H11ClN2O4S/c13-8-2-1-3-9-10(8)11(16)15(12(17)14-9)7-4-5-20(18,19)6-7/h1-3,7H,4-6H2,(H,14,17) |
| InChIKey | YZTTYNFIRBDZLP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |