C13H14N2O4 — CID 117260961
5-hydroxy-3-(oxan-4-yl)-1H-quinazoline-2,4-dione (PubChem CID 117260961) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 5-hydroxy-3-(oxan-4-yl)-1H-quinazoline-2,4-dione.
| Compound Name | 5-hydroxy-3-(oxan-4-yl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117260961 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 5-hydroxy-3-(oxan-4-yl)-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2cccc(O)c2c(=O)n1C1CCOCC1 |
| InChI | InChI=1S/C13H14N2O4/c16-10-3-1-2-9-11(10)12(17)15(13(18)14-9)8-4-6-19-7-5-8/h1-3,8,16H,4-7H2,(H,14,18) |
| InChIKey | ZTCQBOROPSDHON-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |