C12H14N2O3 — CID 117208712
4-hydroxy-3-(oxan-3-yl)-1H-benzimidazol-2-one (PubChem CID 117208712) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-hydroxy-3-(oxan-3-yl)-1H-benzimidazol-2-one.
| Compound Name | 4-hydroxy-3-(oxan-3-yl)-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 117208712 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-hydroxy-3-(oxan-3-yl)-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2cccc(O)c2n1C1CCCOC1 |
| InChI | InChI=1S/C12H14N2O3/c15-10-5-1-4-9-11(10)14(12(16)13-9)8-3-2-6-17-7-8/h1,4-5,8,15H,2-3,6-7H2,(H,13,16) |
| InChIKey | LAWLIHVBULZEOC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |