C12H14N2O4S — CID 117208714
3-(1,1-dioxothian-3-yl)-4-hydroxy-1H-benzimidazol-2-one (PubChem CID 117208714) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is 3-(1,1-dioxothian-3-yl)-4-hydroxy-1H-benzimidazol-2-one.
| Compound Name | 3-(1,1-dioxothian-3-yl)-4-hydroxy-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 117208714 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 3-(1,1-dioxothian-3-yl)-4-hydroxy-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2cccc(O)c2n1C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14N2O4S/c15-10-5-1-4-9-11(10)14(12(16)13-9)8-3-2-6-19(17,18)7-8/h1,4-5,8,15H,2-3,6-7H2,(H,13,16) |
| InChIKey | KTRKVSNGDQZOHU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |