About 3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione
3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione (PubChem CID 117260927) has the molecular formula C12H12N2O5S
and a molecular weight of 296.30 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione.
Molecular Properties
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione |
| PubChem CID | 117260927 |
| Molecular Formula | C12H12N2O5S |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2cccc(O)c2c(=O)n1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H12N2O5S/c15-9-3-1-2-8-10(9)11(16)14(12(17)13-8)7-4-5-20(18,19)6-7/h1-3,7,15H,4-6H2,(H,13,17) |
| InChIKey | PNUNKRNSNQVHSE-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione?
The IUPAC name of 3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione (CID 117260927) is 3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione.
What is the SMILES notation for 3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione?
The canonical SMILES for 3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione is O=c1[nH]c2cccc(O)c2c(=O)n1C1CCS(=O)(=O)C1.
What is the InChIKey of 3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione?
The InChIKey is PNUNKRNSNQVHSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O5S/c15-9-3-1-2-8-10(9)11(16)14(12(17)13-8)7-4-5-20(18,19)6-7/h1-3,7,15H,4-6H2,(H,13,17).
What are the key properties of 3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione?
3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione has a molecular weight of 296.30 g/mol, XLogP of -0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione is sourced from PubChem (CID 117260927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).