C12H12N2O5S — CID 117260927
3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione (PubChem CID 117260927) has the molecular formula C12H12N2O5S and a molecular weight of 296.30 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117260927 |
| Molecular Formula | C12H12N2O5S |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-5-hydroxy-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2cccc(O)c2c(=O)n1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H12N2O5S/c15-9-3-1-2-8-10(9)11(16)14(12(17)13-8)7-4-5-20(18,19)6-7/h1-3,7,15H,4-6H2,(H,13,17) |
| InChIKey | PNUNKRNSNQVHSE-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |