C12H13FN2O3S — CID 117207164
3-(1,1-dioxothian-3-yl)-6-fluoro-1H-benzimidazol-2-one (PubChem CID 117207164) has the molecular formula C12H13FN2O3S and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-(1,1-dioxothian-3-yl)-6-fluoro-1H-benzimidazol-2-one.
| Compound Name | 3-(1,1-dioxothian-3-yl)-6-fluoro-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 117207164 |
| Molecular Formula | C12H13FN2O3S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 3-(1,1-dioxothian-3-yl)-6-fluoro-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2cc(F)ccc2n1C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13FN2O3S/c13-8-3-4-11-10(6-8)14-12(16)15(11)9-2-1-5-19(17,18)7-9/h3-4,6,9H,1-2,5,7H2,(H,14,16) |
| InChIKey | QZDUIJAKOIUKMW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |