C17H23FN4O — CID 70969353
6-fluoro-3-[1-(3-methylpyrrolidin-3-yl)piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 70969353) has the molecular formula C17H23FN4O and a molecular weight of 318.40 g/mol. Its IUPAC name is 6-fluoro-3-[1-(3-methylpyrrolidin-3-yl)piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 6-fluoro-3-[1-(3-methylpyrrolidin-3-yl)piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 70969353 |
| Molecular Formula | C17H23FN4O |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 6-fluoro-3-[1-(3-methylpyrrolidin-3-yl)piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | CC1(N2CCC(n3c(=O)[nH]c4cc(F)ccc43)CC2)CCNC1 |
| InChI | InChI=1S/C17H23FN4O/c1-17(6-7-19-11-17)21-8-4-13(5-9-21)22-15-3-2-12(18)10-14(15)20-16(22)23/h2-3,10,13,19H,4-9,11H2,1H3,(H,20,23) |
| InChIKey | RZXNPICWBHQNEU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 53.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |