C60H81F3N12O9 — CID 162194377
ethyl 3-[4-(6-fluoro-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]-3-methylpyrrolidine-1-carboxylate (PubChem CID 162194377) has the molecular formula C60H81F3N12O9 and a molecular weight of 1171.38 g/mol. Its IUPAC name is ethyl 3-[4-(6-fluoro-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]-3-methylpyrrolidine-1-carboxylate.
| Compound Name | ethyl 3-[4-(6-fluoro-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 162194377 |
| Molecular Formula | C60H81F3N12O9 |
| Molecular Weight | 1171.38 g/mol |
| Exact Mass | 1170.62 |
| IUPAC Name | ethyl 3-[4-(6-fluoro-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]-3-methylpyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C)(N2CCC(n3c(=O)[nH]c4ccc(F)cc43)CC2)C1.CCOC(=O)N1CCC(C)(N2CCC(n3c(=O)[nH]c4ccc(F)cc43)CC2)C1.CCOC(=O)N1CCC(C)(N2CCC(n3c(=O)[nH]c4ccc(F)cc43)CC2)C1 |
| InChI | InChI=1S/3C20H27FN4O3/c3*1-3-28-19(27)23-11-8-20(2,13-23)24-9-6-15(7-10-24)25-17-12-14(21)4-5-16(17)22-18(25)26/h3*4-5,12,15H,3,6-11,13H2,1-2H3,(H,22,26) |
| InChIKey | ZQSZQOJZCUOAOL-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 211.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1171.38 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|