C10H10ClN3O2 — CID 117262250
3-(1-aminoethyl)-5-chloro-1H-quinazoline-2,4-dione (PubChem CID 117262250) has the molecular formula C10H10ClN3O2 and a molecular weight of 239.66 g/mol. Its IUPAC name is 3-(1-aminoethyl)-5-chloro-1H-quinazoline-2,4-dione.
| Compound Name | 3-(1-aminoethyl)-5-chloro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117262250 |
| Molecular Formula | C10H10ClN3O2 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 3-(1-aminoethyl)-5-chloro-1H-quinazoline-2,4-dione |
| SMILES | CC(N)n1c(=O)[nH]c2cccc(Cl)c2c1=O |
| InChI | InChI=1S/C10H10ClN3O2/c1-5(12)14-9(15)8-6(11)3-2-4-7(8)13-10(14)16/h2-5H,12H2,1H3,(H,13,16) |
| InChIKey | QBDWXZGJJFYZQK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |