C9H8ClN3O2 — CID 117262244
3-(aminomethyl)-5-chloro-1H-quinazoline-2,4-dione (PubChem CID 117262244) has the molecular formula C9H8ClN3O2 and a molecular weight of 225.64 g/mol. Its IUPAC name is 3-(aminomethyl)-5-chloro-1H-quinazoline-2,4-dione.
| Compound Name | 3-(aminomethyl)-5-chloro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117262244 |
| Molecular Formula | C9H8ClN3O2 |
| Molecular Weight | 225.64 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 3-(aminomethyl)-5-chloro-1H-quinazoline-2,4-dione |
| SMILES | NCn1c(=O)[nH]c2cccc(Cl)c2c1=O |
| InChI | InChI=1S/C9H8ClN3O2/c10-5-2-1-3-6-7(5)8(14)13(4-11)9(15)12-6/h1-3H,4,11H2,(H,12,15) |
| InChIKey | HXDNPYOSQAZRGW-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.64 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |