C22H15Cl2N5O2 — CID 123677235
8-chloro-3-[1-(2-chloro-8-oxo-7H-purin-9-yl)ethyl]-2-phenylisoquinolin-1-one (PubChem CID 123677235) has the molecular formula C22H15Cl2N5O2 and a molecular weight of 452.30 g/mol. Its IUPAC name is 8-chloro-3-[1-(2-chloro-8-oxo-7H-purin-9-yl)ethyl]-2-phenylisoquinolin-1-one.
| Compound Name | 8-chloro-3-[1-(2-chloro-8-oxo-7H-purin-9-yl)ethyl]-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 123677235 |
| Molecular Formula | C22H15Cl2N5O2 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 8-chloro-3-[1-(2-chloro-8-oxo-7H-purin-9-yl)ethyl]-2-phenylisoquinolin-1-one |
| SMILES | CC(c1cc2cccc(Cl)c2c(=O)n1-c1ccccc1)n1c(=O)[nH]c2cnc(Cl)nc21 |
| InChI | InChI=1S/C22H15Cl2N5O2/c1-12(28-19-16(26-22(28)31)11-25-21(24)27-19)17-10-13-6-5-9-15(23)18(13)20(30)29(17)14-7-3-2-4-8-14/h2-12H,1H3,(H,26,31) |
| InChIKey | GSQQFEYUOKOEJQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |