C22H17ClN6O — CID 78045174
8-chloro-2-phenyl-3-[1-(7H-purin-2-ylamino)ethyl]isoquinolin-1-one (PubChem CID 78045174) has the molecular formula C22H17ClN6O and a molecular weight of 416.87 g/mol. Its IUPAC name is 8-chloro-2-phenyl-3-[1-(7H-purin-2-ylamino)ethyl]isoquinolin-1-one.
| Compound Name | 8-chloro-2-phenyl-3-[1-(7H-purin-2-ylamino)ethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 78045174 |
| Molecular Formula | C22H17ClN6O |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 8-chloro-2-phenyl-3-[1-(7H-purin-2-ylamino)ethyl]isoquinolin-1-one |
| SMILES | CC(Nc1ncc2[nH]cnc2n1)c1cc2cccc(Cl)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C22H17ClN6O/c1-13(27-22-24-11-17-20(28-22)26-12-25-17)18-10-14-6-5-9-16(23)19(14)21(30)29(18)15-7-3-2-4-8-15/h2-13H,1H3,(H2,24,25,26,27,28) |
| InChIKey | FPZWDWSPBPKEMR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |