C23H19N6O- — CID 144514647
1-(8-methyl-1-oxo-2-phenylisoquinolin-3-yl)ethyl-(7H-purin-2-yl)azanide (PubChem CID 144514647) has the molecular formula C23H19N6O- and a molecular weight of 395.45 g/mol. Its IUPAC name is 1-(8-methyl-1-oxo-2-phenylisoquinolin-3-yl)ethyl-(7H-purin-2-yl)azanide.
| Compound Name | 1-(8-methyl-1-oxo-2-phenylisoquinolin-3-yl)ethyl-(7H-purin-2-yl)azanide |
|---|---|
| PubChem CID | 144514647 |
| Molecular Formula | C23H19N6O- |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-(8-methyl-1-oxo-2-phenylisoquinolin-3-yl)ethyl-(7H-purin-2-yl)azanide |
| SMILES | Cc1cccc2cc(C(C)[N-]c3ncc4[nH]cnc4n3)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C23H19N6O/c1-14-7-6-8-16-11-19(29(22(30)20(14)16)17-9-4-3-5-10-17)15(2)27-23-24-12-18-21(28-23)26-13-25-18/h3-13,15H,1-2H3,(H-,24,25,26,27,28)/q-1 |
| InChIKey | IJPNDMHZMDACNM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |