C22H19ClN4O — CID 71273660
3-[(1S)-1-[(4-amino-2-pyridinyl)amino]ethyl]-8-chloro-2-phenylisoquinolin-1-one (PubChem CID 71273660) has the molecular formula C22H19ClN4O and a molecular weight of 390.87 g/mol. Its IUPAC name is 3-[(1S)-1-[(4-amino-2-pyridinyl)amino]ethyl]-8-chloro-2-phenylisoquinolin-1-one.
| Compound Name | 3-[(1S)-1-[(4-amino-2-pyridinyl)amino]ethyl]-8-chloro-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 71273660 |
| Molecular Formula | C22H19ClN4O |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 3-[(1S)-1-[(4-amino-2-pyridinyl)amino]ethyl]-8-chloro-2-phenylisoquinolin-1-one |
| SMILES | C[C@H](Nc1cc(N)ccn1)c1cc2cccc(Cl)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C22H19ClN4O/c1-14(26-20-13-16(24)10-11-25-20)19-12-15-6-5-9-18(23)21(15)22(28)27(19)17-7-3-2-4-8-17/h2-14H,1H3,(H3,24,25,26)/t14-/m0/s1 |
| InChIKey | LNNWUTZLXSAJNR-AWEZNQCLSA-N |
| XLogP | 4.79 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |