C22H21ClN4O — CID 175124579
8-chloro-3-[(1S)-1-[(1-methyl-2H-pyrimidin-5-yl)amino]ethyl]-2-phenylisoquinolin-1-one (PubChem CID 175124579) has the molecular formula C22H21ClN4O and a molecular weight of 392.89 g/mol. Its IUPAC name is 8-chloro-3-[(1S)-1-[(1-methyl-2H-pyrimidin-5-yl)amino]ethyl]-2-phenylisoquinolin-1-one.
| Compound Name | 8-chloro-3-[(1S)-1-[(1-methyl-2H-pyrimidin-5-yl)amino]ethyl]-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 175124579 |
| Molecular Formula | C22H21ClN4O |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 8-chloro-3-[(1S)-1-[(1-methyl-2H-pyrimidin-5-yl)amino]ethyl]-2-phenylisoquinolin-1-one |
| SMILES | C[C@H](NC1=CN(C)CN=C1)c1cc2cccc(Cl)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C22H21ClN4O/c1-15(25-17-12-24-14-26(2)13-17)20-11-16-7-6-10-19(23)21(16)22(28)27(20)18-8-4-3-5-9-18/h3-13,15,25H,14H2,1-2H3/t15-/m0/s1 |
| InChIKey | MLGJEWGQSHSGFV-HNNXBMFYSA-N |
| XLogP | 4.11 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |