C23H19ClN6O — CID 70351065
8-chloro-3-[(1S)-1-[(9-methylpurin-6-yl)amino]ethyl]-2-phenylisoquinolin-1-one (PubChem CID 70351065) has the molecular formula C23H19ClN6O and a molecular weight of 430.90 g/mol. Its IUPAC name is 8-chloro-3-[(1S)-1-[(9-methylpurin-6-yl)amino]ethyl]-2-phenylisoquinolin-1-one.
| Compound Name | 8-chloro-3-[(1S)-1-[(9-methylpurin-6-yl)amino]ethyl]-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 70351065 |
| Molecular Formula | C23H19ClN6O |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 8-chloro-3-[(1S)-1-[(9-methylpurin-6-yl)amino]ethyl]-2-phenylisoquinolin-1-one |
| SMILES | C[C@H](Nc1ncnc2c1ncn2C)c1cc2cccc(Cl)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C23H19ClN6O/c1-14(28-21-20-22(26-12-25-21)29(2)13-27-20)18-11-15-7-6-10-17(24)19(15)23(31)30(18)16-8-4-3-5-9-16/h3-14H,1-2H3,(H,25,26,28)/t14-/m0/s1 |
| InChIKey | YXGOYKAWZQFSET-AWEZNQCLSA-N |
| XLogP | 4.49 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |