C23H20Cl2N4O — CID 123191127
3-[1-[[5-(aminomethyl)-2-chloro-4-pyridinyl]amino]ethyl]-8-chloro-2-phenylisoquinolin-1-one (PubChem CID 123191127) has the molecular formula C23H20Cl2N4O and a molecular weight of 439.35 g/mol. Its IUPAC name is 3-[1-[[5-(aminomethyl)-2-chloro-4-pyridinyl]amino]ethyl]-8-chloro-2-phenylisoquinolin-1-one.
| Compound Name | 3-[1-[[5-(aminomethyl)-2-chloro-4-pyridinyl]amino]ethyl]-8-chloro-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 123191127 |
| Molecular Formula | C23H20Cl2N4O |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 3-[1-[[5-(aminomethyl)-2-chloro-4-pyridinyl]amino]ethyl]-8-chloro-2-phenylisoquinolin-1-one |
| SMILES | CC(Nc1cc(Cl)ncc1CN)c1cc2cccc(Cl)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C23H20Cl2N4O/c1-14(28-19-11-21(25)27-13-16(19)12-26)20-10-15-6-5-9-18(24)22(15)23(30)29(20)17-7-3-2-4-8-17/h2-11,13-14H,12,26H2,1H3,(H,27,28) |
| InChIKey | CACYMGGLWCGJOX-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|