C22H18ClIN6O — CID 142800135
3-[1-(4-amino-3-iodo-2H-pyrazolo[4,3-d]pyrimidin-1-yl)ethyl]-8-chloro-2-phenylisoquinolin-1-one (PubChem CID 142800135) has the molecular formula C22H18ClIN6O and a molecular weight of 544.78 g/mol. Its IUPAC name is 3-[1-(4-amino-3-iodo-2H-pyrazolo[4,3-d]pyrimidin-1-yl)ethyl]-8-chloro-2-phenylisoquinolin-1-one.
| Compound Name | 3-[1-(4-amino-3-iodo-2H-pyrazolo[4,3-d]pyrimidin-1-yl)ethyl]-8-chloro-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 142800135 |
| Molecular Formula | C22H18ClIN6O |
| Molecular Weight | 544.78 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | 3-[1-(4-amino-3-iodo-2H-pyrazolo[4,3-d]pyrimidin-1-yl)ethyl]-8-chloro-2-phenylisoquinolin-1-one |
| SMILES | CC(c1cc2cccc(Cl)c2c(=O)n1-c1ccccc1)N1NC(I)=C2C1=CN=CN2N |
| InChI | InChI=1S/C22H18ClIN6O/c1-13(30-18-11-26-12-28(25)20(18)21(24)27-30)17-10-14-6-5-9-16(23)19(14)22(31)29(17)15-7-3-2-4-8-15/h2-13,27H,25H2,1H3 |
| InChIKey | ZXNBIWNYHOOWAF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.78 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|