C18H14ClF3N2O — CID 71235928
3-[(1S)-1-aminoethyl]-8-chloro-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one (PubChem CID 71235928) has the molecular formula C18H14ClF3N2O and a molecular weight of 366.77 g/mol. Its IUPAC name is 3-[(1S)-1-aminoethyl]-8-chloro-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one.
| Compound Name | 3-[(1S)-1-aminoethyl]-8-chloro-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 71235928 |
| Molecular Formula | C18H14ClF3N2O |
| Molecular Weight | 366.77 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 3-[(1S)-1-aminoethyl]-8-chloro-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
| SMILES | C[C@H](N)c1cc2cccc(Cl)c2c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14ClF3N2O/c1-10(23)15-8-11-4-2-7-14(19)16(11)17(25)24(15)13-6-3-5-12(9-13)18(20,21)22/h2-10H,23H2,1H3/t10-/m0/s1 |
| InChIKey | KSEGOUUHPWDLFX-JTQLQIEISA-N |
| XLogP | 4.68 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.77 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |