C14H12ClN3O2 — CID 78044037
3-(1-aminoethyl)-8-chloro-2-(1,2-oxazol-3-yl)isoquinolin-1-one (PubChem CID 78044037) has the molecular formula C14H12ClN3O2 and a molecular weight of 289.72 g/mol. Its IUPAC name is 3-(1-aminoethyl)-8-chloro-2-(1,2-oxazol-3-yl)isoquinolin-1-one.
| Compound Name | 3-(1-aminoethyl)-8-chloro-2-(1,2-oxazol-3-yl)isoquinolin-1-one |
|---|---|
| PubChem CID | 78044037 |
| Molecular Formula | C14H12ClN3O2 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3-(1-aminoethyl)-8-chloro-2-(1,2-oxazol-3-yl)isoquinolin-1-one |
| SMILES | CC(N)c1cc2cccc(Cl)c2c(=O)n1-c1ccon1 |
| InChI | InChI=1S/C14H12ClN3O2/c1-8(16)11-7-9-3-2-4-10(15)13(9)14(19)18(11)12-5-6-20-17-12/h2-8H,16H2,1H3 |
| InChIKey | ABWAGXDCVBUVSM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |