C23H27BN2O3 — CID 123261572
3-(1-aminoethyl)-2-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1-one (PubChem CID 123261572) has the molecular formula C23H27BN2O3 and a molecular weight of 390.29 g/mol. Its IUPAC name is 3-(1-aminoethyl)-2-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1-one.
| Compound Name | 3-(1-aminoethyl)-2-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1-one |
|---|---|
| PubChem CID | 123261572 |
| Molecular Formula | C23H27BN2O3 |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 3-(1-aminoethyl)-2-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1-one |
| SMILES | CC(N)c1cc2cccc(B3OC(C)(C)C(C)(C)O3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C23H27BN2O3/c1-15(25)19-14-16-10-9-13-18(24-28-22(2,3)23(4,5)29-24)20(16)21(27)26(19)17-11-7-6-8-12-17/h6-15H,25H2,1-5H3 |
| InChIKey | SCCFCFNDHBYKAY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|