C21H29N5O5 — CID 175973024
methyl 2-[4-[(3R)-3-(methoxymethyl)piperazin-1-yl]cyclohexyl]-5-nitroindazole-6-carboxylate (PubChem CID 175973024) has the molecular formula C21H29N5O5 and a molecular weight of 431.49 g/mol. Its IUPAC name is methyl 2-[4-[(3R)-3-(methoxymethyl)piperazin-1-yl]cyclohexyl]-5-nitroindazole-6-carboxylate.
| Compound Name | methyl 2-[4-[(3R)-3-(methoxymethyl)piperazin-1-yl]cyclohexyl]-5-nitroindazole-6-carboxylate |
|---|---|
| PubChem CID | 175973024 |
| Molecular Formula | C21H29N5O5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | methyl 2-[4-[(3R)-3-(methoxymethyl)piperazin-1-yl]cyclohexyl]-5-nitroindazole-6-carboxylate |
| SMILES | COC[C@H]1CN(C2CCC(n3cc4cc([N+](=O)[O-])c(C(=O)OC)cc4n3)CC2)CCN1 |
| InChI | InChI=1S/C21H29N5O5/c1-30-13-15-12-24(8-7-22-15)16-3-5-17(6-4-16)25-11-14-9-20(26(28)29)18(21(27)31-2)10-19(14)23-25/h9-11,15-17,22H,3-8,12-13H2,1-2H3/t15-,16?,17?/m1/s1 |
| InChIKey | ARCRBBZTEBGFGQ-KLAILNCOSA-N |
| XLogP | 2.13 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|