C14H17N3O5 — CID 176862157
1-[5-nitro-2-(oxan-2-yl)indazol-6-yl]ethane-1,1-diol (PubChem CID 176862157) has the molecular formula C14H17N3O5 and a molecular weight of 307.31 g/mol. Its IUPAC name is 1-[5-nitro-2-(oxan-2-yl)indazol-6-yl]ethane-1,1-diol.
| Compound Name | 1-[5-nitro-2-(oxan-2-yl)indazol-6-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 176862157 |
| Molecular Formula | C14H17N3O5 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-[5-nitro-2-(oxan-2-yl)indazol-6-yl]ethane-1,1-diol |
| SMILES | CC(O)(O)c1cc2nn(C3CCCCO3)cc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17N3O5/c1-14(18,19)10-7-11-9(6-12(10)17(20)21)8-16(15-11)13-4-2-3-5-22-13/h6-8,13,18-19H,2-5H2,1H3 |
| InChIKey | XWBPXBMYTGOXOF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|