C19H29N5O5 — CID 99908932
4-nitro-1-[(2R)-oxan-2-yl]-N-[1-[(2S)-oxan-2-yl]piperidin-4-yl]pyrazole-3-carboxamide (PubChem CID 99908932) has the molecular formula C19H29N5O5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-nitro-1-[(2R)-oxan-2-yl]-N-[1-[(2S)-oxan-2-yl]piperidin-4-yl]pyrazole-3-carboxamide.
| Compound Name | 4-nitro-1-[(2R)-oxan-2-yl]-N-[1-[(2S)-oxan-2-yl]piperidin-4-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 99908932 |
| Molecular Formula | C19H29N5O5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 4-nitro-1-[(2R)-oxan-2-yl]-N-[1-[(2S)-oxan-2-yl]piperidin-4-yl]pyrazole-3-carboxamide |
| SMILES | O=C(NC1CCN([C@@H]2CCCCO2)CC1)c1nn([C@H]2CCCCO2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H29N5O5/c25-19(20-14-7-9-22(10-8-14)16-5-1-3-11-28-16)18-15(24(26)27)13-23(21-18)17-6-2-4-12-29-17/h13-14,16-17H,1-12H2,(H,20,25)/t16-,17+/m0/s1 |
| InChIKey | LLRJFJVCOKOAAP-DLBZAZTESA-N |
| XLogP | 2.21 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|